Aplindore

Composé chimique
tendance
OctoberNovemberDecember2021FebruaryMarch0500
formule chimique
C₂₂H₂₂N₂O₇
media
SMILES isomérique
c1ccc(cc1)CNC[C@H]2COc3ccc4c(c3O2)CC(=O)N4.C(=C/C(=O)O)C(=O)O
numéro CAS
identifiant ChemSpider
InChIKey
identifiant KEGG
identifiant PubChem (CID)
identifiant Unique Ingredient Identifier