Aspergillic Acid

Composé chimique
tendance
December2021FebruaryMarchAprilMay0500
structure chimique
formule chimique
C₁₂H₂₀N₂O₃
media
SMILES canonique
CCC(C)C1=CN=C(C(=O)N1O)CC(C)C
numéro CAS
identifiant ChEBI
identifiant ChemSpider
identifiant DSSTOX
InChIKey
identifiant PubChem (CID)
identifiant RÖMPP-Online