Antrafenine

Chemical compound
trends
2021FebruaryMarchAprilMayJune0500
alias
Antrafenine
mass
588.196 dalton
chemical formula
C₃₀H₂₆F₆N₄O₂
media
canonical SMILES
C1CN(CCN1CCOC(=O)C2=CC=CC=C2NC3=C4C=CC(=CC4=NC=C3)C(F)(F)F)C5=CC=CC(=C5)C(F)(F)F
World Health Organisation International Nonproprietary Name
Antrafenine (english)
Wikipedia creation date
1/26/2007
Wikipedia incoming links count
Wikipedia opening text
Antrafenine (Stakane) is a phenylpiperazine derivative drug invented in 1979. It acts as an analgesic and anti-inflammatory drug with similar efficacy to naproxen, but is not widely used as it has largely been replaced by newer drugs.
Wikipedia redirect
C30H26F6N4O2
Wikipedia URL
CAS Registry Number
ChEMBL ID
ChemSpider ID
DrugBank ID
InChIKey
MassBank Accession ID
MeSH concept ID
PubChem CID
UNII