Ap4A

Chemical compound
trends
SeptemberOctoberNovemberDecember20210500
chemical structure
alias
5',5'''-diadenosine tetraphosphate
adenosyl-P4
diadenosine tetraphosphate
P(1),P(4)-bis(5'-adenosyl) tetraphosphate tetraanion
P(1),P(4)-bis(5'-adenosyl) tetraphosphate
AppppA
mass
832.017 dalton
chemical formula
C₂₀H₂₄N₁₀O₁₉P₄-₄
physically interacts with
Purinergic Receptor P2Y13
Purinergic Receptor P2Y2
media
canonical SMILES
C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC4C(C(C(O4)N5C=NC6=C5N=CN=C6N)O)O)O)O
isomeric SMILES
C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=NC6=C5N=CN=C6N)O)O)O)O
Wikipedia creation date
2/18/2010
Wikipedia incoming links count
Wikipedia opening text
Diadenosine tetraphosphate or Ap4A is a putative alarmone, ubiquitous in nature being common to everything from bacteria to humans. Adenosine polyphosphates are capable of inducing multiple physiological effects. The molecule's role as a second messenger has recently been discovered in The LysRS-Ap4A-MITF signaling pathway. Myxococcus xanthus is a type of Gram-negative bacteria, and M. xanthus lysyl-tRNA synthetase (LysS) is an enzyme from the bacteria that synthesizes diadenosine tetraphosphates (Ap4A) when adenosine triphosphate (ATP) is present. Diadenosine pentaphosphate (Ap5A) is synthesized from Ap4A with ATP.
Wikipedia redirect
Diadenosine tetraphosphate
C20H28N10O19P4
Wikipedia URL
ChEBI ID
ChemSpider ID
Guide to Pharmacology Ligand ID
InChIKey
PubChem CID
Reaxys registry number
7459962