Aplidine

Chemical compound
trends
JulyAugustSeptemberOctoberNovemberDecember0500
chemical structure
alias
Dehydrodidemnin B
plitidepsina
Plitidepsin
plitidepsium
plitidepsine
media
isomeric SMILES
O=C([C@@H](NC([C@@H](C)C([C@@H](OC(C[C@H](O)[C@H](NC([C@@H](NC([C@H](N(C([C@H]1N(C(C(C)=O)=O)CCC1)=O)C)CC(C)C)=O)[C@@H](C)OC([C@H](CC2=CC=C(OC)C=C2)N3C)=O)=O)[C@@H](C)CC)=O)C(C)C)=O)=O)CC(C)C)N4[C@H](C3=O)CCC4
Wikipedia creation date
8/10/2006
Wikipedia incoming links count
Wikipedia opening text
Plitidepsin (also known as dehydrodidemnin B, marketed by PharmaMar, S.A. under the trade name Aplidin) is a chemical compound extracted from the ascidian Aplidium albicans. It is currently undergoing clinical trial testing. It is a member of the class of compounds known as didemnins.
Wikipedia redirect
Aplidin
Dihydrodidemnin B
Aplidine
Dehydrodidemnin B
Wikipedia URL
CAS Registry Number
ChEBI ID
ChemSpider ID
DrugBank ID
DSSTOX substance identifier
KEGG ID
KNApSAcK ID