Apocholic Acid

Chemical compound
trends
OctoberNovemberDecember2021FebruaryMarch0500
chemical structure
alias
3alpha,12alpha-Dihydroxy-5beta-chol-8(14)-en-24-oic acid
(4R)-4-[(3R,5R,9R,10S,12S,13R,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]valeric acid
(4R)-4-[(3R,5R,9R,10S,12S,13R,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
mass
390.277 dalton
chemical formula
C₂₄H₃₈O₄
media
canonical SMILES
CC(CCC(=O)O)C1CCC2=C3CCC4CC(CCC4(C3CC(C12C)O)C)O
isomeric SMILES
C[C@H](CCC(=O)O)[C@H]1CCC2=C3CC[C@@H]4C[C@@H](CC[C@@]4([C@H]3C[C@@H]([C@]12C)O)C)O
Wikipedia creation date
11/30/2009
Wikipedia incoming links count
Wikipedia opening text
Apocholic acid is an unsaturated bile acid first characterized in the 1920s. It has questionable carcinogenic activity as experimentally, sarcomas were induced in mice with injection of desoxycholic acid. The salts and esters of apocholic acid are known as apocholates.
Wikipedia redirect
Apocholate
Wikipedia URL
CAS Registry Number
ChEBI ID
ChemSpider ID
InChIKey
KEGG ID
LIPID MAPS ID
NSC number
PubChem CID
UNII