Asocainol

Chemical compound
trends
December2021FebruaryMarchAprilMay0500
mass
417.23 dalton
chemical formula
C₂₇H₃₁NO₃
canonical SMILES
CN1CCC2=C(C=C(C=C2)OC)C3=C(CC1CCC4=CC=CC=C4)C=CC(=C3O)OC
Wikipedia creation date
9/11/2009
Wikipedia incoming links count
Wikipedia opening text
Asocainol is a class 1a anti-arrhythmic compound.
Wikipedia URL
CAS Registry Number
ChEMBL ID
ChemSpider ID
InChIKey
PubChem CID
UNII