Asoxime Chloride

Chemical compound
trends
MayJuneJulyAugustSeptemberOctober0500
chemical formula
C₁₄H₁₆Cl₂N₄O₃
media
canonical SMILES
C1=CC(=C[NH+]=O)N(C=C1)COC[N+]2=CC=C(C=C2)C(=O)N.[Cl-].[Cl-]
c1cc[n+](c(c1)/C=N/O)COC[n+]2ccc(cc2)C(=O)N.[Cl-].[Cl-]
Wikipedia creation date
10/10/2010
Wikipedia incoming links count
Wikipedia opening text
Asoxime chloride, or more commonly HI-6, is a Hagedorn oxime used in the treatment of organophosphate poisoning.
Wikipedia redirect
HI-6
Asoxime
C14H16Cl2N4O3
Wikipedia URL
CAS Registry Number
ChEMBL ID
ChemSpider ID
MeSH descriptor ID