N(4)-(Beta-N-Acetyl-d-Glucosaminyl)-l-Asparagine

Chemical compound
trends
MayJuneJulyAugustSeptemberOctober0500
chemical structure
alias
2-acetamido-N(1)-L-beta-aspartyl-2-deoxy-beta-D-glucopyranosylamine
beta-N-acetylglucosaminyl-L-asparagine
AADG
2-Acetamido-1-N-(4'-L-aspartyl)-2-deoxy-beta-D-glucopyranosylamine
2-Acetamido-1-(beta-L-aspartamido)-1,2-dideoxy-beta-D-glucose
N-Acetylglucosaminylasparagine
2-acetamido-N-L-beta-aspartyl-2-deoxy-beta-D-glucopyranosylamine
4-N-2-Acetamido-2-deoxy-beta-delta-glucopyranosyl-L-asparagine
Aspartylglucosylamine
2-Acetamido-1-beta-(L-aspartamido)-1,2-dideoxy-delta-glucose
N-(2-(Acetylamino)-2-deoxy-beta-delta-glucopyranosyl)L-Asparagine
N(4)-(beta-N-Acetyl-D-glucosaminyl)-L-asparagine
Acetylglucosaminylasparagine
b-D-GlcNAc-1->N-Asn
(2S)-2-amino-3-{[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamoyl}propanoic acid
beta-D-GlcNAc-1->N-Asn
(N-gamma-(2-Acetamido-2-deoxy-beta-D-gluco-pyranosyl)-L-asparagine
N-(2-Acetylamino)-2-deoxy-beta-D-glucopyranosyl-L-asparagine
2-Acetamido-1-N-(4'-L-aspartyl)-2-deoxy-beta-delta-glucopyranosylamine
H-Asn(GlcNAc-beta-D)-OH
N(4)-(Acetyl-beta-D-glucosaminyl)asparagine
Asparaginylglucosamine
N-(2-Acetylamino)-2-deoxy-beta-delta-glucopyranosyl-L-asparagine
Aspartylglucosamine
(N-gamma-(2-Acetamido-2-deoxy-beta-delta-gluco-pyranosyl)-L-asparagine
2-Acetamido-1-beta-(L-aspartamido)-1,2-dideoxy-D-glucose
N-(2-(Acetylamino)-2-deoxy-beta-D-glucopyranosyl)L-Asparagine
2-Acetamido-1-b-(L-aspartamido)-1,2-dideoxy-D-glucose
(N-g-(2-Acetamido-2-deoxy-b-D-gluco-pyranosyl)-L-asparagine
H-Asn(GlcNAc-b-D)-OH
4-N-2-Acetamido-2-deoxy-beta-D-glucopyranosyl-L-asparagine
beta-delta-GlcNAc-1->N-Asn
mass
335.133 dalton
chemical formula
C₁₂H₂₁N₃O₈
media
canonical SMILES
CC(=O)NC1C(C(C(OC1NC(=O)CC(C(=O)O)N)CO)O)O
isomeric SMILES
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)C[C@@H](C(=O)O)N)CO)O)O
Wikipedia creation date
6/1/2008
Wikipedia incoming links count
Wikipedia redirect
C12H21N3O8
Wikipedia URL
CAS Registry Number
ChEBI ID
ChemSpider ID
Human Metabolome Database ID
InChIKey
PubChem CID