Aspergillic Acid

Chemical compound
trends
MayJuneJulyAugustSeptemberOctober0500
chemical structure
chemical formula
C₁₂H₂₀N₂O₃
media
canonical SMILES
CCC(C)C1=CN=C(C(=O)N1O)CC(C)C
Wikipedia creation date
10/26/2012
Wikipedia incoming links count
Wikipedia opening text
Aspergillic acid is an organic chemical compound with the molecular formula C12H20N2O2. It has a pale yellow crystalline appearance. Aspergillic acid is most commonly known as an antibiotic and antifungal agent that is derived from certain strains of the fungus Aspergillus flavus.
Wikipedia redirect
Aspergillic Acid
C12H20N2O2
Wikipedia URL
CAS Registry Number
ChEBI ID
ChemSpider ID
DSSTOX substance identifier
PubChem CID
Römpp online ID