Asperlicin

Chemical compound
trends
JuneJulyAugustSeptemberOctober0500
mass
535.222 dalton
chemical formula
C₃₁H₂₉N₅O₄
media
canonical SMILES
CC(C)CC1C(=O)N2C(N1)C(C3=CC=CC=C32)(CC4C5=NC6=CC=CC=C6C(=O)N5C7=CC=CC=C7C(=O)N4)O
isomeric SMILES
CC(C)C[C@H]1C(=O)N2[C@H](N1)[C@@](C3=CC=CC=C32)(C[C@H]4C5=NC6=CC=CC=C6C(=O)N5C7=CC=CC=C7C(=O)N4)O
Wikipedia creation date
11/17/2008
Wikipedia incoming links count
Wikipedia opening text
Asperlicin is a mycotoxin, derived from the fungus Aspergillus alliaceus. It acts as a selective antagonist for the cholecystokinin receptor CCKA, and has been used as a lead compound for the development of a number of novel CCKA antagonists with potential clinical applications.
Wikipedia redirect
C31H29N5O4
Wikipedia URL
CAS Registry Number
ChEBI ID
ChEMBL ID
ChemSpider ID
DSSTOX substance identifier
InChIKey
MeSH descriptor ID
PubChem CID
UNII